C11H15BrO3 — CID 175448284
2-(4-bromophenyl)propanal;ethane-1,2-diol (PubChem CID 175448284) has the molecular formula C11H15BrO3 and a molecular weight of 275.14 g/mol. Its IUPAC name is 2-(4-bromophenyl)propanal;ethane-1,2-diol.
| Compound Name | 2-(4-bromophenyl)propanal;ethane-1,2-diol |
|---|---|
| PubChem CID | 175448284 |
| Molecular Formula | C11H15BrO3 |
| Molecular Weight | 275.14 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-(4-bromophenyl)propanal;ethane-1,2-diol |
| SMILES | CC(C=O)c1ccc(Br)cc1.OCCO |
| InChI | InChI=1S/C9H9BrO.C2H6O2/c1-7(6-11)8-2-4-9(10)5-3-8;3-1-2-4/h2-7H,1H3;3-4H,1-2H2 |
| InChIKey | OEEQJZJUHJBFOO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.14 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|