About azulene;phosphane
azulene;phosphane (PubChem CID 175448344) has the molecular formula C10H11P
and a molecular weight of 162.17 g/mol. Its IUPAC name is azulene;phosphane.
Molecular Properties
| Compound Name | azulene;phosphane |
| PubChem CID | 175448344 |
| Molecular Formula | C10H11P |
| Molecular Weight | 162.17 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | azulene;phosphane |
| SMILES | P.c1ccc2cccc-2cc1 |
| InChI | InChI=1S/C10H8.H3P/c1-2-5-9-7-4-8-10(9)6-3-1;/h1-8H;1H3 |
| InChIKey | PNEAAZVNIYRYAG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze azulene;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azulene;phosphane?
The IUPAC name of azulene;phosphane (CID 175448344) is azulene;phosphane.
What is the SMILES notation for azulene;phosphane?
The canonical SMILES for azulene;phosphane is P.c1ccc2cccc-2cc1.
What is the InChIKey of azulene;phosphane?
The InChIKey is PNEAAZVNIYRYAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.H3P/c1-2-5-9-7-4-8-10(9)6-3-1;/h1-8H;1H3.
What are the key properties of azulene;phosphane?
azulene;phosphane has a molecular weight of 162.17 g/mol, XLogP of 2.85, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for azulene;phosphane is sourced from PubChem (CID 175448344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).