3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid

C7H6Cl2N2O2 — CID 175448371

IUPAC3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid
SMILESCc1c(Cl)nc(Cl)c(N)c1C(=O)O
InChIInChI=1S/C7H6Cl2N2O2/c1-2-3(7(12)13)4(10)6(9)11-5(2)8/h10H2,1H3,(H,12,13)
InChIKeyBUTFAYWEUGJYLO-UHFFFAOYSA-N
MW221.04 g/mol
LogP1.98
Rot. Bonds1

About 3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid

3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid (PubChem CID 175448371) has the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. Its IUPAC name is 3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid.

Molecular Properties

Compound Name3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid
PubChem CID175448371
Molecular FormulaC7H6Cl2N2O2
Molecular Weight221.04 g/mol
Exact Mass219.98
IUPAC Name3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid
SMILESCc1c(Cl)nc(Cl)c(N)c1C(=O)O
InChIInChI=1S/C7H6Cl2N2O2/c1-2-3(7(12)13)4(10)6(9)11-5(2)8/h10H2,1H3,(H,12,13)
InChIKeyBUTFAYWEUGJYLO-UHFFFAOYSA-N
XLogP1.98
TPSA76.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500221.04
LogP ≤ 51.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}

Analyze 3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid?
The IUPAC name of 3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid (CID 175448371) is 3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid.
What is the SMILES notation for 3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid?
The canonical SMILES for 3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid is Cc1c(Cl)nc(Cl)c(N)c1C(=O)O.
What is the InChIKey of 3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid?
The InChIKey is BUTFAYWEUGJYLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Cl2N2O2/c1-2-3(7(12)13)4(10)6(9)11-5(2)8/h10H2,1H3,(H,12,13).
What are the key properties of 3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid?
3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid has a molecular weight of 221.04 g/mol, XLogP of 1.98, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,6-dichloro-5-methylpyridine-4-carboxylic acid is sourced from PubChem (CID 175448371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).