About 6-ethylimino-3,4,5-trimethylhexanoic acid
6-ethylimino-3,4,5-trimethylhexanoic acid (PubChem CID 175448924) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is 6-ethylimino-3,4,5-trimethylhexanoic acid.
Molecular Properties
| Compound Name | 6-ethylimino-3,4,5-trimethylhexanoic acid |
| PubChem CID | 175448924 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 6-ethylimino-3,4,5-trimethylhexanoic acid |
| SMILES | CC/N=C/C(C)C(C)C(C)CC(=O)O |
| InChI | InChI=1S/C11H21NO2/c1-5-12-7-9(3)10(4)8(2)6-11(13)14/h7-10H,5-6H2,1-4H3,(H,13,14)/b12-7+ |
| InChIKey | ONJUMNHVBFXLEX-KPKJPENVSA-N |
| XLogP | 2.46 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 6-ethylimino-3,4,5-trimethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethylimino-3,4,5-trimethylhexanoic acid?
The IUPAC name of 6-ethylimino-3,4,5-trimethylhexanoic acid (CID 175448924) is 6-ethylimino-3,4,5-trimethylhexanoic acid.
What is the SMILES notation for 6-ethylimino-3,4,5-trimethylhexanoic acid?
The canonical SMILES for 6-ethylimino-3,4,5-trimethylhexanoic acid is CC/N=C/C(C)C(C)C(C)CC(=O)O.
What is the InChIKey of 6-ethylimino-3,4,5-trimethylhexanoic acid?
The InChIKey is ONJUMNHVBFXLEX-KPKJPENVSA-N. The full InChI is InChI=1S/C11H21NO2/c1-5-12-7-9(3)10(4)8(2)6-11(13)14/h7-10H,5-6H2,1-4H3,(H,13,14)/b12-7+.
What are the key properties of 6-ethylimino-3,4,5-trimethylhexanoic acid?
6-ethylimino-3,4,5-trimethylhexanoic acid has a molecular weight of 199.29 g/mol, XLogP of 2.46, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethylimino-3,4,5-trimethylhexanoic acid is sourced from PubChem (CID 175448924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).