C14H21BO2 — CID 175449947
(5,6,7,8-tetramethyl-1,2,3,4-tetrahydronaphthalen-2-yl)boronic acid (PubChem CID 175449947) has the molecular formula C14H21BO2 and a molecular weight of 232.13 g/mol. Its IUPAC name is (5,6,7,8-tetramethyl-1,2,3,4-tetrahydronaphthalen-2-yl)boronic acid.
| Compound Name | (5,6,7,8-tetramethyl-1,2,3,4-tetrahydronaphthalen-2-yl)boronic acid |
|---|---|
| PubChem CID | 175449947 |
| Molecular Formula | C14H21BO2 |
| Molecular Weight | 232.13 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | (5,6,7,8-tetramethyl-1,2,3,4-tetrahydronaphthalen-2-yl)boronic acid |
| SMILES | Cc1c(C)c(C)c2c(c1C)CCC(B(O)O)C2 |
| InChI | InChI=1S/C14H21BO2/c1-8-9(2)11(4)14-7-12(15(16)17)5-6-13(14)10(8)3/h12,16-17H,5-7H2,1-4H3 |
| InChIKey | FPTJZXYHHIWKMM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.13 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|