About 1-benzofuran;3H-1,3,4-oxadiazole-2-thione
1-benzofuran;3H-1,3,4-oxadiazole-2-thione (PubChem CID 175449959) has the molecular formula C10H8N2O2S
and a molecular weight of 220.25 g/mol. Its IUPAC name is 1-benzofuran;3H-1,3,4-oxadiazole-2-thione.
Molecular Properties
| Compound Name | 1-benzofuran;3H-1,3,4-oxadiazole-2-thione |
| PubChem CID | 175449959 |
| Molecular Formula | C10H8N2O2S |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.03 |
| IUPAC Name | 1-benzofuran;3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nco1.c1ccc2occc2c1 |
| InChI | InChI=1S/C8H6O.C2H2N2OS/c1-2-4-8-7(3-1)5-6-9-8;6-2-4-3-1-5-2/h1-6H;1H,(H,4,6) |
| InChIKey | UVKOJEVMFHCIQG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 54.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran;3H-1,3,4-oxadiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran;3H-1,3,4-oxadiazole-2-thione?
The IUPAC name of 1-benzofuran;3H-1,3,4-oxadiazole-2-thione (CID 175449959) is 1-benzofuran;3H-1,3,4-oxadiazole-2-thione.
What is the SMILES notation for 1-benzofuran;3H-1,3,4-oxadiazole-2-thione?
The canonical SMILES for 1-benzofuran;3H-1,3,4-oxadiazole-2-thione is S=c1[nH]nco1.c1ccc2occc2c1.
What is the InChIKey of 1-benzofuran;3H-1,3,4-oxadiazole-2-thione?
The InChIKey is UVKOJEVMFHCIQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O.C2H2N2OS/c1-2-4-8-7(3-1)5-6-9-8;6-2-4-3-1-5-2/h1-6H;1H,(H,4,6).
What are the key properties of 1-benzofuran;3H-1,3,4-oxadiazole-2-thione?
1-benzofuran;3H-1,3,4-oxadiazole-2-thione has a molecular weight of 220.25 g/mol, XLogP of 3.16, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran;3H-1,3,4-oxadiazole-2-thione is sourced from PubChem (CID 175449959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).