About 1,1-di(pyrazin-2-yl)ethane-1,2-diamine
1,1-di(pyrazin-2-yl)ethane-1,2-diamine (PubChem CID 175450075) has the molecular formula C10H12N6
and a molecular weight of 216.25 g/mol. Its IUPAC name is 1,1-di(pyrazin-2-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1,1-di(pyrazin-2-yl)ethane-1,2-diamine |
| PubChem CID | 175450075 |
| Molecular Formula | C10H12N6 |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 1,1-di(pyrazin-2-yl)ethane-1,2-diamine |
| SMILES | NCC(N)(c1cnccn1)c1cnccn1 |
| InChI | InChI=1S/C10H12N6/c11-7-10(12,8-5-13-1-3-15-8)9-6-14-2-4-16-9/h1-6H,7,11-12H2 |
| InChIKey | RZASDWNBNSSBNI-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1,1-di(pyrazin-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-di(pyrazin-2-yl)ethane-1,2-diamine?
The IUPAC name of 1,1-di(pyrazin-2-yl)ethane-1,2-diamine (CID 175450075) is 1,1-di(pyrazin-2-yl)ethane-1,2-diamine.
What is the SMILES notation for 1,1-di(pyrazin-2-yl)ethane-1,2-diamine?
The canonical SMILES for 1,1-di(pyrazin-2-yl)ethane-1,2-diamine is NCC(N)(c1cnccn1)c1cnccn1.
What is the InChIKey of 1,1-di(pyrazin-2-yl)ethane-1,2-diamine?
The InChIKey is RZASDWNBNSSBNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N6/c11-7-10(12,8-5-13-1-3-15-8)9-6-14-2-4-16-9/h1-6H,7,11-12H2.
What are the key properties of 1,1-di(pyrazin-2-yl)ethane-1,2-diamine?
1,1-di(pyrazin-2-yl)ethane-1,2-diamine has a molecular weight of 216.25 g/mol, XLogP of -0.57, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-di(pyrazin-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 175450075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).