C24H22BrN3O5S — CID 175450845
[2-bromo-4-(4-carbamoyl-1H-benzimidazol-2-yl)-6-methoxyphenyl] 2,4,6-trimethylbenzenesulfonate (PubChem CID 175450845) has the molecular formula C24H22BrN3O5S and a molecular weight of 544.43 g/mol. Its IUPAC name is [2-bromo-4-(4-carbamoyl-1H-benzimidazol-2-yl)-6-methoxyphenyl] 2,4,6-trimethylbenzenesulfonate.
| Compound Name | [2-bromo-4-(4-carbamoyl-1H-benzimidazol-2-yl)-6-methoxyphenyl] 2,4,6-trimethylbenzenesulfonate |
|---|---|
| PubChem CID | 175450845 |
| Molecular Formula | C24H22BrN3O5S |
| Molecular Weight | 544.43 g/mol |
| Exact Mass | 543.05 |
| IUPAC Name | [2-bromo-4-(4-carbamoyl-1H-benzimidazol-2-yl)-6-methoxyphenyl] 2,4,6-trimethylbenzenesulfonate |
| SMILES | COc1cc(-c2nc3c(C(N)=O)cccc3[nH]2)cc(Br)c1OS(=O)(=O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C24H22BrN3O5S/c1-12-8-13(2)22(14(3)9-12)34(30,31)33-21-17(25)10-15(11-19(21)32-4)24-27-18-7-5-6-16(23(26)29)20(18)28-24/h5-11H,1-4H3,(H2,26,29)(H,27,28) |
| InChIKey | GLEGMISPFJWWOQ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 124.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.43 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|