C21H32F3N3O4 — CID 175451619
(2,2,2-trifluoroacetyl) (2S)-2-[[(3S)-1-[4-(dimethylamino)-4-methylpent-2-ynyl]pyrrolidine-3-carbonyl]-methylamino]-3-methylbutanoate (PubChem CID 175451619) has the molecular formula C21H32F3N3O4 and a molecular weight of 447.50 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2S)-2-[[(3S)-1-[4-(dimethylamino)-4-methylpent-2-ynyl]pyrrolidine-3-carbonyl]-methylamino]-3-methylbutanoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2S)-2-[[(3S)-1-[4-(dimethylamino)-4-methylpent-2-ynyl]pyrrolidine-3-carbonyl]-methylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 175451619 |
| Molecular Formula | C21H32F3N3O4 |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2S)-2-[[(3S)-1-[4-(dimethylamino)-4-methylpent-2-ynyl]pyrrolidine-3-carbonyl]-methylamino]-3-methylbutanoate |
| SMILES | CC(C)[C@@H](C(=O)OC(=O)C(F)(F)F)N(C)C(=O)[C@H]1CCN(CC#CC(C)(C)N(C)C)C1 |
| InChI | InChI=1S/C21H32F3N3O4/c1-14(2)16(18(29)31-19(30)21(22,23)24)26(7)17(28)15-9-12-27(13-15)11-8-10-20(3,4)25(5)6/h14-16H,9,11-13H2,1-7H3/t15-,16-/m0/s1 |
| InChIKey | KPNBQTQYGJTTFW-HOTGVXAUSA-N |
| XLogP | 1.77 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|