C28H33N3O2P+ — CID 175451649
2-amino-3-(1H-imidazol-5-yl)propanoic acid;butyl(triphenyl)phosphanium (PubChem CID 175451649) has the molecular formula C28H33N3O2P+ and a molecular weight of 474.57 g/mol. Its IUPAC name is 2-amino-3-(1H-imidazol-5-yl)propanoic acid;butyl(triphenyl)phosphanium.
| Compound Name | 2-amino-3-(1H-imidazol-5-yl)propanoic acid;butyl(triphenyl)phosphanium |
|---|---|
| PubChem CID | 175451649 |
| Molecular Formula | C28H33N3O2P+ |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | 2-amino-3-(1H-imidazol-5-yl)propanoic acid;butyl(triphenyl)phosphanium |
| SMILES | CCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C22H24P.C6H9N3O2/c1-2-3-19-23(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22;7-5(6(10)11)1-4-2-8-3-9-4/h4-18H,2-3,19H2,1H3;2-3,5H,1,7H2,(H,8,9)(H,10,11)/q+1; |
| InChIKey | FGIZLVOBMOJJKT-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|