About 2,4-dibromo-4,5-dihydro-1,3-oxazole
2,4-dibromo-4,5-dihydro-1,3-oxazole (PubChem CID 175451748) has the molecular formula C3H3Br2NO
and a molecular weight of 228.87 g/mol. Its IUPAC name is 2,4-dibromo-4,5-dihydro-1,3-oxazole.
Molecular Properties
| Compound Name | 2,4-dibromo-4,5-dihydro-1,3-oxazole |
| PubChem CID | 175451748 |
| Molecular Formula | C3H3Br2NO |
| Molecular Weight | 228.87 g/mol |
| Exact Mass | 226.86 |
| IUPAC Name | 2,4-dibromo-4,5-dihydro-1,3-oxazole |
| SMILES | BrC1=NC(Br)CO1 |
| InChI | InChI=1S/C3H3Br2NO/c4-2-1-7-3(5)6-2/h2H,1H2 |
| InChIKey | BTYMVNPBPHPHJS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.87 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibromo-4,5-dihydro-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-4,5-dihydro-1,3-oxazole?
The IUPAC name of 2,4-dibromo-4,5-dihydro-1,3-oxazole (CID 175451748) is 2,4-dibromo-4,5-dihydro-1,3-oxazole.
What is the SMILES notation for 2,4-dibromo-4,5-dihydro-1,3-oxazole?
The canonical SMILES for 2,4-dibromo-4,5-dihydro-1,3-oxazole is BrC1=NC(Br)CO1.
What is the InChIKey of 2,4-dibromo-4,5-dihydro-1,3-oxazole?
The InChIKey is BTYMVNPBPHPHJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3Br2NO/c4-2-1-7-3(5)6-2/h2H,1H2.
What are the key properties of 2,4-dibromo-4,5-dihydro-1,3-oxazole?
2,4-dibromo-4,5-dihydro-1,3-oxazole has a molecular weight of 228.87 g/mol, XLogP of 1.49, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-4,5-dihydro-1,3-oxazole is sourced from PubChem (CID 175451748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).