C32H43N3O5 — CID 175451787
2-[3-[1-[4-[(3S)-1-aminopyrrolidin-3-yl]oxy-3-cyclohexylbenzoyl]piperidin-3-yl]phenoxy]-2-methylpropanoic acid (PubChem CID 175451787) has the molecular formula C32H43N3O5 and a molecular weight of 549.71 g/mol. Its IUPAC name is 2-[3-[1-[4-[(3S)-1-aminopyrrolidin-3-yl]oxy-3-cyclohexylbenzoyl]piperidin-3-yl]phenoxy]-2-methylpropanoic acid.
| Compound Name | 2-[3-[1-[4-[(3S)-1-aminopyrrolidin-3-yl]oxy-3-cyclohexylbenzoyl]piperidin-3-yl]phenoxy]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 175451787 |
| Molecular Formula | C32H43N3O5 |
| Molecular Weight | 549.71 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | 2-[3-[1-[4-[(3S)-1-aminopyrrolidin-3-yl]oxy-3-cyclohexylbenzoyl]piperidin-3-yl]phenoxy]-2-methylpropanoic acid |
| SMILES | CC(C)(Oc1cccc(C2CCCN(C(=O)c3ccc(O[C@H]4CCN(N)C4)c(C4CCCCC4)c3)C2)c1)C(=O)O |
| InChI | InChI=1S/C32H43N3O5/c1-32(2,31(37)38)40-26-12-6-10-23(18-26)25-11-7-16-34(20-25)30(36)24-13-14-29(39-27-15-17-35(33)21-27)28(19-24)22-8-4-3-5-9-22/h6,10,12-14,18-19,22,25,27H,3-5,7-9,11,15-17,20-21,33H2,1-2H3,(H,37,38)/t25?,27-/m0/s1 |
| InChIKey | GDIXSCJPLGMCPR-GPNIZQGCSA-N |
| XLogP | 5.32 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.71 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|