About 2-(1-ethenyl-1,2,4-triazol-3-yl)acetonitrile;hydrobromide
2-(1-ethenyl-1,2,4-triazol-3-yl)acetonitrile;hydrobromide (PubChem CID 175452152) has the molecular formula C6H7BrN4
and a molecular weight of 215.05 g/mol. Its IUPAC name is 2-(1-ethenyl-1,2,4-triazol-3-yl)acetonitrile;hydrobromide.
Molecular Properties
| Compound Name | 2-(1-ethenyl-1,2,4-triazol-3-yl)acetonitrile;hydrobromide |
| PubChem CID | 175452152 |
| Molecular Formula | C6H7BrN4 |
| Molecular Weight | 215.05 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | 2-(1-ethenyl-1,2,4-triazol-3-yl)acetonitrile;hydrobromide |
| SMILES | Br.C=Cn1cnc(CC#N)n1 |
| InChI | InChI=1S/C6H6N4.BrH/c1-2-10-5-8-6(9-10)3-4-7;/h2,5H,1,3H2;1H |
| InChIKey | RWPGNHDBTVXRIQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.05 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1-ethenyl-1,2,4-triazol-3-yl)acetonitrile;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-ethenyl-1,2,4-triazol-3-yl)acetonitrile;hydrobromide?
The IUPAC name of 2-(1-ethenyl-1,2,4-triazol-3-yl)acetonitrile;hydrobromide (CID 175452152) is 2-(1-ethenyl-1,2,4-triazol-3-yl)acetonitrile;hydrobromide.
What is the SMILES notation for 2-(1-ethenyl-1,2,4-triazol-3-yl)acetonitrile;hydrobromide?
The canonical SMILES for 2-(1-ethenyl-1,2,4-triazol-3-yl)acetonitrile;hydrobromide is Br.C=Cn1cnc(CC#N)n1.
What is the InChIKey of 2-(1-ethenyl-1,2,4-triazol-3-yl)acetonitrile;hydrobromide?
The InChIKey is RWPGNHDBTVXRIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4.BrH/c1-2-10-5-8-6(9-10)3-4-7;/h2,5H,1,3H2;1H.
What are the key properties of 2-(1-ethenyl-1,2,4-triazol-3-yl)acetonitrile;hydrobromide?
2-(1-ethenyl-1,2,4-triazol-3-yl)acetonitrile;hydrobromide has a molecular weight of 215.05 g/mol, XLogP of 1.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethenyl-1,2,4-triazol-3-yl)acetonitrile;hydrobromide is sourced from PubChem (CID 175452152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).