C14H29F3N4O2S — CID 175452367
8-(trifluoromethylsulfonyl)-1,4,8,14-tetrazacycloheptadecane (PubChem CID 175452367) has the molecular formula C14H29F3N4O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is 8-(trifluoromethylsulfonyl)-1,4,8,14-tetrazacycloheptadecane.
| Compound Name | 8-(trifluoromethylsulfonyl)-1,4,8,14-tetrazacycloheptadecane |
|---|---|
| PubChem CID | 175452367 |
| Molecular Formula | C14H29F3N4O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 8-(trifluoromethylsulfonyl)-1,4,8,14-tetrazacycloheptadecane |
| SMILES | O=S(=O)(N1CCCCCNCCCNCCNCCC1)C(F)(F)F |
| InChI | InChI=1S/C14H29F3N4O2S/c15-14(16,17)24(22,23)21-12-3-1-2-6-18-7-4-8-19-10-11-20-9-5-13-21/h18-20H,1-13H2 |
| InChIKey | YNONZUPVGFZJGV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |