C22H31N5O4S — CID 175453597
N-[3-(diethylamino)propyl]-2-morpholin-2-ylimidazo[2,1-b][1,3]benzothiazole-6-carboxamide;formic acid (PubChem CID 175453597) has the molecular formula C22H31N5O4S and a molecular weight of 461.59 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-morpholin-2-ylimidazo[2,1-b][1,3]benzothiazole-6-carboxamide;formic acid.
| Compound Name | N-[3-(diethylamino)propyl]-2-morpholin-2-ylimidazo[2,1-b][1,3]benzothiazole-6-carboxamide;formic acid |
|---|---|
| PubChem CID | 175453597 |
| Molecular Formula | C22H31N5O4S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-morpholin-2-ylimidazo[2,1-b][1,3]benzothiazole-6-carboxamide;formic acid |
| SMILES | CCN(CC)CCCNC(=O)c1ccc2c(c1)sc1nc(C3CNCCO3)cn12.O=CO |
| InChI | InChI=1S/C21H29N5O2S.CH2O2/c1-3-25(4-2)10-5-8-23-20(27)15-6-7-17-19(12-15)29-21-24-16(14-26(17)21)18-13-22-9-11-28-18;2-1-3/h6-7,12,14,18,22H,3-5,8-11,13H2,1-2H3,(H,23,27);1H,(H,2,3) |
| InChIKey | MAOXMPCTCQPIPQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|