About 3-[(5-nitro-1,3-thiazol-2-yl)amino]-2-[3-(oxan-4-ylamino)phenyl]-3-oxopropanoic acid
3-[(5-nitro-1,3-thiazol-2-yl)amino]-2-[3-(oxan-4-ylamino)phenyl]-3-oxopropanoic acid (PubChem CID 175453872) has the molecular formula C17H18N4O6S
and a molecular weight of 406.42 g/mol. Its IUPAC name is 3-[(5-nitro-1,3-thiazol-2-yl)amino]-2-[3-(oxan-4-ylamino)phenyl]-3-oxopropanoic acid.
Molecular Properties
| Compound Name | 3-[(5-nitro-1,3-thiazol-2-yl)amino]-2-[3-(oxan-4-ylamino)phenyl]-3-oxopropanoic acid |
| PubChem CID | 175453872 |
| Molecular Formula | C17H18N4O6S |
| Molecular Weight | 406.42 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 3-[(5-nitro-1,3-thiazol-2-yl)amino]-2-[3-(oxan-4-ylamino)phenyl]-3-oxopropanoic acid |
| SMILES | O=C(O)C(C(=O)Nc1ncc([N+](=O)[O-])s1)c1cccc(NC2CCOCC2)c1 |
| InChI | InChI=1S/C17H18N4O6S/c22-15(20-17-18-9-13(28-17)21(25)26)14(16(23)24)10-2-1-3-12(8-10)19-11-4-6-27-7-5-11/h1-3,8-9,11,14,19H,4-7H2,(H,23,24)(H,18,20,22) |
| InChIKey | ULINDXRBAGHFPK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 143.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-nitro-1,3-thiazol-2-yl)amino]-2-[3-(oxan-4-ylamino)phenyl]-3-oxopropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-nitro-1,3-thiazol-2-yl)amino]-2-[3-(oxan-4-ylamino)phenyl]-3-oxopropanoic acid?
The IUPAC name of 3-[(5-nitro-1,3-thiazol-2-yl)amino]-2-[3-(oxan-4-ylamino)phenyl]-3-oxopropanoic acid (CID 175453872) is 3-[(5-nitro-1,3-thiazol-2-yl)amino]-2-[3-(oxan-4-ylamino)phenyl]-3-oxopropanoic acid.
What is the SMILES notation for 3-[(5-nitro-1,3-thiazol-2-yl)amino]-2-[3-(oxan-4-ylamino)phenyl]-3-oxopropanoic acid?
The canonical SMILES for 3-[(5-nitro-1,3-thiazol-2-yl)amino]-2-[3-(oxan-4-ylamino)phenyl]-3-oxopropanoic acid is O=C(O)C(C(=O)Nc1ncc([N+](=O)[O-])s1)c1cccc(NC2CCOCC2)c1.
What is the InChIKey of 3-[(5-nitro-1,3-thiazol-2-yl)amino]-2-[3-(oxan-4-ylamino)phenyl]-3-oxopropanoic acid?
The InChIKey is ULINDXRBAGHFPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O6S/c22-15(20-17-18-9-13(28-17)21(25)26)14(16(23)24)10-2-1-3-12(8-10)19-11-4-6-27-7-5-11/h1-3,8-9,11,14,19H,4-7H2,(H,23,24)(H,18,20,22).
What are the key properties of 3-[(5-nitro-1,3-thiazol-2-yl)amino]-2-[3-(oxan-4-ylamino)phenyl]-3-oxopropanoic acid?
3-[(5-nitro-1,3-thiazol-2-yl)amino]-2-[3-(oxan-4-ylamino)phenyl]-3-oxopropanoic acid has a molecular weight of 406.42 g/mol, XLogP of 2.45, 7 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-nitro-1,3-thiazol-2-yl)amino]-2-[3-(oxan-4-ylamino)phenyl]-3-oxopropanoic acid is sourced from PubChem (CID 175453872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).