About alumane;(Z)-octadec-9-en-1-amine
alumane;(Z)-octadec-9-en-1-amine (PubChem CID 175454084) has the molecular formula C18H40AlN
and a molecular weight of 297.51 g/mol. Its IUPAC name is alumane;(Z)-octadec-9-en-1-amine.
Molecular Properties
| Compound Name | alumane;(Z)-octadec-9-en-1-amine |
| PubChem CID | 175454084 |
| Molecular Formula | C18H40AlN |
| Molecular Weight | 297.51 g/mol |
| Exact Mass | 297.30 |
| IUPAC Name | alumane;(Z)-octadec-9-en-1-amine |
| SMILES | CCCCCCCC/C=C\CCCCCCCCN.[AlH3] |
| InChI | InChI=1S/C18H37N.Al.3H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;;;;/h9-10H,2-8,11-19H2,1H3;;;;/b10-9-;;;; |
| InChIKey | SAQQVDPDQASNSY-HKIWRJGFSA-N |
| XLogP | 4.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze alumane;(Z)-octadec-9-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of alumane;(Z)-octadec-9-en-1-amine?
The IUPAC name of alumane;(Z)-octadec-9-en-1-amine (CID 175454084) is alumane;(Z)-octadec-9-en-1-amine.
What is the SMILES notation for alumane;(Z)-octadec-9-en-1-amine?
The canonical SMILES for alumane;(Z)-octadec-9-en-1-amine is CCCCCCCC/C=C\CCCCCCCCN.[AlH3].
What is the InChIKey of alumane;(Z)-octadec-9-en-1-amine?
The InChIKey is SAQQVDPDQASNSY-HKIWRJGFSA-N. The full InChI is InChI=1S/C18H37N.Al.3H/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19;;;;/h9-10H,2-8,11-19H2,1H3;;;;/b10-9-;;;;.
What are the key properties of alumane;(Z)-octadec-9-en-1-amine?
alumane;(Z)-octadec-9-en-1-amine has a molecular weight of 297.51 g/mol, XLogP of 4.80, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for alumane;(Z)-octadec-9-en-1-amine is sourced from PubChem (CID 175454084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).