About 4-chloro-2,6-diethyl-3,5-dimethylphenol
4-chloro-2,6-diethyl-3,5-dimethylphenol (PubChem CID 175454218) has the molecular formula C12H17ClO
and a molecular weight of 212.72 g/mol. Its IUPAC name is 4-chloro-2,6-diethyl-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-chloro-2,6-diethyl-3,5-dimethylphenol |
| PubChem CID | 175454218 |
| Molecular Formula | C12H17ClO |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 4-chloro-2,6-diethyl-3,5-dimethylphenol |
| SMILES | CCc1c(C)c(Cl)c(C)c(CC)c1O |
| InChI | InChI=1S/C12H17ClO/c1-5-9-7(3)11(13)8(4)10(6-2)12(9)14/h14H,5-6H2,1-4H3 |
| InChIKey | OHQGLHMMDLQEJU-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-chloro-2,6-diethyl-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,6-diethyl-3,5-dimethylphenol?
The IUPAC name of 4-chloro-2,6-diethyl-3,5-dimethylphenol (CID 175454218) is 4-chloro-2,6-diethyl-3,5-dimethylphenol.
What is the SMILES notation for 4-chloro-2,6-diethyl-3,5-dimethylphenol?
The canonical SMILES for 4-chloro-2,6-diethyl-3,5-dimethylphenol is CCc1c(C)c(Cl)c(C)c(CC)c1O.
What is the InChIKey of 4-chloro-2,6-diethyl-3,5-dimethylphenol?
The InChIKey is OHQGLHMMDLQEJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17ClO/c1-5-9-7(3)11(13)8(4)10(6-2)12(9)14/h14H,5-6H2,1-4H3.
What are the key properties of 4-chloro-2,6-diethyl-3,5-dimethylphenol?
4-chloro-2,6-diethyl-3,5-dimethylphenol has a molecular weight of 212.72 g/mol, XLogP of 3.79, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,6-diethyl-3,5-dimethylphenol is sourced from PubChem (CID 175454218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).