About 2-[4-[(2-amino-1,3-thiazol-5-yl)methyl]piperazin-1-yl]-N-pyrazin-2-ylacetamide
2-[4-[(2-amino-1,3-thiazol-5-yl)methyl]piperazin-1-yl]-N-pyrazin-2-ylacetamide (PubChem CID 175454326) has the molecular formula C14H19N7OS
and a molecular weight of 333.42 g/mol. Its IUPAC name is 2-[4-[(2-amino-1,3-thiazol-5-yl)methyl]piperazin-1-yl]-N-pyrazin-2-ylacetamide.
Molecular Properties
| Compound Name | 2-[4-[(2-amino-1,3-thiazol-5-yl)methyl]piperazin-1-yl]-N-pyrazin-2-ylacetamide |
| PubChem CID | 175454326 |
| Molecular Formula | C14H19N7OS |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 2-[4-[(2-amino-1,3-thiazol-5-yl)methyl]piperazin-1-yl]-N-pyrazin-2-ylacetamide |
| SMILES | Nc1ncc(CN2CCN(CC(=O)Nc3cnccn3)CC2)s1 |
| InChI | InChI=1S/C14H19N7OS/c15-14-18-7-11(23-14)9-20-3-5-21(6-4-20)10-13(22)19-12-8-16-1-2-17-12/h1-2,7-8H,3-6,9-10H2,(H2,15,18)(H,17,19,22) |
| InChIKey | QSFWHTSAIOJGSV-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-[4-[(2-amino-1,3-thiazol-5-yl)methyl]piperazin-1-yl]-N-pyrazin-2-ylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2-amino-1,3-thiazol-5-yl)methyl]piperazin-1-yl]-N-pyrazin-2-ylacetamide?
The IUPAC name of 2-[4-[(2-amino-1,3-thiazol-5-yl)methyl]piperazin-1-yl]-N-pyrazin-2-ylacetamide (CID 175454326) is 2-[4-[(2-amino-1,3-thiazol-5-yl)methyl]piperazin-1-yl]-N-pyrazin-2-ylacetamide.
What is the SMILES notation for 2-[4-[(2-amino-1,3-thiazol-5-yl)methyl]piperazin-1-yl]-N-pyrazin-2-ylacetamide?
The canonical SMILES for 2-[4-[(2-amino-1,3-thiazol-5-yl)methyl]piperazin-1-yl]-N-pyrazin-2-ylacetamide is Nc1ncc(CN2CCN(CC(=O)Nc3cnccn3)CC2)s1.
What is the InChIKey of 2-[4-[(2-amino-1,3-thiazol-5-yl)methyl]piperazin-1-yl]-N-pyrazin-2-ylacetamide?
The InChIKey is QSFWHTSAIOJGSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N7OS/c15-14-18-7-11(23-14)9-20-3-5-21(6-4-20)10-13(22)19-12-8-16-1-2-17-12/h1-2,7-8H,3-6,9-10H2,(H2,15,18)(H,17,19,22).
What are the key properties of 2-[4-[(2-amino-1,3-thiazol-5-yl)methyl]piperazin-1-yl]-N-pyrazin-2-ylacetamide?
2-[4-[(2-amino-1,3-thiazol-5-yl)methyl]piperazin-1-yl]-N-pyrazin-2-ylacetamide has a molecular weight of 333.42 g/mol, XLogP of 0.27, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2-amino-1,3-thiazol-5-yl)methyl]piperazin-1-yl]-N-pyrazin-2-ylacetamide is sourced from PubChem (CID 175454326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).