About 3-(4-tert-butylphenyl)-1-iodo-2,4-dimethylbenzene
3-(4-tert-butylphenyl)-1-iodo-2,4-dimethylbenzene (PubChem CID 175455440) has the molecular formula C18H21I
and a molecular weight of 364.27 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-1-iodo-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 3-(4-tert-butylphenyl)-1-iodo-2,4-dimethylbenzene |
| PubChem CID | 175455440 |
| Molecular Formula | C18H21I |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 3-(4-tert-butylphenyl)-1-iodo-2,4-dimethylbenzene |
| SMILES | Cc1ccc(I)c(C)c1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H21I/c1-12-6-11-16(19)13(2)17(12)14-7-9-15(10-8-14)18(3,4)5/h6-11H,1-5H3 |
| InChIKey | RQNUMSPSLLKWKM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-tert-butylphenyl)-1-iodo-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-tert-butylphenyl)-1-iodo-2,4-dimethylbenzene?
The IUPAC name of 3-(4-tert-butylphenyl)-1-iodo-2,4-dimethylbenzene (CID 175455440) is 3-(4-tert-butylphenyl)-1-iodo-2,4-dimethylbenzene.
What is the SMILES notation for 3-(4-tert-butylphenyl)-1-iodo-2,4-dimethylbenzene?
The canonical SMILES for 3-(4-tert-butylphenyl)-1-iodo-2,4-dimethylbenzene is Cc1ccc(I)c(C)c1-c1ccc(C(C)(C)C)cc1.
What is the InChIKey of 3-(4-tert-butylphenyl)-1-iodo-2,4-dimethylbenzene?
The InChIKey is RQNUMSPSLLKWKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21I/c1-12-6-11-16(19)13(2)17(12)14-7-9-15(10-8-14)18(3,4)5/h6-11H,1-5H3.
What are the key properties of 3-(4-tert-butylphenyl)-1-iodo-2,4-dimethylbenzene?
3-(4-tert-butylphenyl)-1-iodo-2,4-dimethylbenzene has a molecular weight of 364.27 g/mol, XLogP of 5.87, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-tert-butylphenyl)-1-iodo-2,4-dimethylbenzene is sourced from PubChem (CID 175455440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).