About 3-(2,6-dimethylphenyl)-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide
3-(2,6-dimethylphenyl)-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide (PubChem CID 175455471) has the molecular formula C20H17F3N2O2
and a molecular weight of 374.36 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 3-(2,6-dimethylphenyl)-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide |
| PubChem CID | 175455471 |
| Molecular Formula | C20H17F3N2O2 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1cccc(C)c1-c1noc(C)c1C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H17F3N2O2/c1-11-6-4-7-12(2)16(11)18-17(13(3)27-25-18)19(26)24-15-9-5-8-14(10-15)20(21,22)23/h4-10H,1-3H3,(H,24,26) |
| InChIKey | FDGANCXKYUKFTD-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,6-dimethylphenyl)-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dimethylphenyl)-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide?
The IUPAC name of 3-(2,6-dimethylphenyl)-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide (CID 175455471) is 3-(2,6-dimethylphenyl)-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 3-(2,6-dimethylphenyl)-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide?
The canonical SMILES for 3-(2,6-dimethylphenyl)-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide is Cc1cccc(C)c1-c1noc(C)c1C(=O)Nc1cccc(C(F)(F)F)c1.
What is the InChIKey of 3-(2,6-dimethylphenyl)-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide?
The InChIKey is FDGANCXKYUKFTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F3N2O2/c1-11-6-4-7-12(2)16(11)18-17(13(3)27-25-18)19(26)24-15-9-5-8-14(10-15)20(21,22)23/h4-10H,1-3H3,(H,24,26).
What are the key properties of 3-(2,6-dimethylphenyl)-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide?
3-(2,6-dimethylphenyl)-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide has a molecular weight of 374.36 g/mol, XLogP of 5.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylphenyl)-5-methyl-N-[3-(trifluoromethyl)phenyl]-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 175455471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).