About 2,5-dichlorocyclohexa-2,5-diene-1,4-diol
2,5-dichlorocyclohexa-2,5-diene-1,4-diol (PubChem CID 175455765) has the molecular formula C12H12Cl4O4
and a molecular weight of 362.04 g/mol. Its IUPAC name is 2,5-dichlorocyclohexa-2,5-diene-1,4-diol.
Molecular Properties
| Compound Name | 2,5-dichlorocyclohexa-2,5-diene-1,4-diol |
| PubChem CID | 175455765 |
| Molecular Formula | C12H12Cl4O4 |
| Molecular Weight | 362.04 g/mol |
| Exact Mass | 359.95 |
| IUPAC Name | 2,5-dichlorocyclohexa-2,5-diene-1,4-diol |
| SMILES | OC1C=C(Cl)C(O)C=C1Cl.OC1C=C(Cl)C(O)C=C1Cl |
| InChI | InChI=1S/2C6H6Cl2O2/c2*7-3-1-5(9)4(8)2-6(3)10/h2*1-2,5-6,9-10H |
| InChIKey | DBELQQDVTIQITR-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.04 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dichlorocyclohexa-2,5-diene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichlorocyclohexa-2,5-diene-1,4-diol?
The IUPAC name of 2,5-dichlorocyclohexa-2,5-diene-1,4-diol (CID 175455765) is 2,5-dichlorocyclohexa-2,5-diene-1,4-diol.
What is the SMILES notation for 2,5-dichlorocyclohexa-2,5-diene-1,4-diol?
The canonical SMILES for 2,5-dichlorocyclohexa-2,5-diene-1,4-diol is OC1C=C(Cl)C(O)C=C1Cl.OC1C=C(Cl)C(O)C=C1Cl.
What is the InChIKey of 2,5-dichlorocyclohexa-2,5-diene-1,4-diol?
The InChIKey is DBELQQDVTIQITR-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H6Cl2O2/c2*7-3-1-5(9)4(8)2-6(3)10/h2*1-2,5-6,9-10H.
What are the key properties of 2,5-dichlorocyclohexa-2,5-diene-1,4-diol?
2,5-dichlorocyclohexa-2,5-diene-1,4-diol has a molecular weight of 362.04 g/mol, XLogP of 1.93, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichlorocyclohexa-2,5-diene-1,4-diol is sourced from PubChem (CID 175455765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).