About potassium;hydride;oxiran-2-yl methanesulfonate
potassium;hydride;oxiran-2-yl methanesulfonate (PubChem CID 175455854) has the molecular formula C3H7KO4S
and a molecular weight of 178.25 g/mol. Its IUPAC name is potassium;hydride;oxiran-2-yl methanesulfonate.
Molecular Properties
| Compound Name | potassium;hydride;oxiran-2-yl methanesulfonate |
| PubChem CID | 175455854 |
| Molecular Formula | C3H7KO4S |
| Molecular Weight | 178.25 g/mol |
| Exact Mass | 177.97 |
| IUPAC Name | potassium;hydride;oxiran-2-yl methanesulfonate |
| SMILES | CS(=O)(=O)OC1CO1.[H-].[K+] |
| InChI | InChI=1S/C3H6O4S.K.H/c1-8(4,5)7-3-2-6-3;;/h3H,2H2,1H3;;/q;+1;-1 |
| InChIKey | PBEUXRKMTZAFOG-UHFFFAOYSA-N |
| XLogP | -3.56 |
| TPSA | 55.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.25 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;oxiran-2-yl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;oxiran-2-yl methanesulfonate?
The IUPAC name of potassium;hydride;oxiran-2-yl methanesulfonate (CID 175455854) is potassium;hydride;oxiran-2-yl methanesulfonate.
What is the SMILES notation for potassium;hydride;oxiran-2-yl methanesulfonate?
The canonical SMILES for potassium;hydride;oxiran-2-yl methanesulfonate is CS(=O)(=O)OC1CO1.[H-].[K+].
What is the InChIKey of potassium;hydride;oxiran-2-yl methanesulfonate?
The InChIKey is PBEUXRKMTZAFOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O4S.K.H/c1-8(4,5)7-3-2-6-3;;/h3H,2H2,1H3;;/q;+1;-1.
What are the key properties of potassium;hydride;oxiran-2-yl methanesulfonate?
potassium;hydride;oxiran-2-yl methanesulfonate has a molecular weight of 178.25 g/mol, XLogP of -3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;oxiran-2-yl methanesulfonate is sourced from PubChem (CID 175455854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).