C44H32N4O2Sn — CID 175455908
(3,5,7,8-tetraphenylporphyrin-2-yl)-λ2-stannane;dihydrate (PubChem CID 175455908) has the molecular formula C44H32N4O2Sn and a molecular weight of 767.48 g/mol. Its IUPAC name is (3,5,7,8-tetraphenylporphyrin-2-yl)-λ2-stannane;dihydrate.
| Compound Name | (3,5,7,8-tetraphenylporphyrin-2-yl)-λ2-stannane;dihydrate |
|---|---|
| PubChem CID | 175455908 |
| Molecular Formula | C44H32N4O2Sn |
| Molecular Weight | 767.48 g/mol |
| Exact Mass | 768.15 |
| IUPAC Name | (3,5,7,8-tetraphenylporphyrin-2-yl)-λ2-stannane;dihydrate |
| SMILES | O.O.[SnH]C1=C(c2ccccc2)/C2=C(\c3ccccc3)C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C(c1ccccc1)=C3c1ccccc1 |
| InChI | InChI=1S/C44H27N4.2H2O.Sn.H/c1-5-13-29(14-6-1)38-27-37-26-35-22-21-33(45-35)25-34-23-24-36(46-34)28-39-40(30-15-7-2-8-16-30)41(31-17-9-3-10-18-31)44(48-39)42(43(38)47-37)32-19-11-4-12-20-32;;;;/h1-26,28H;2*1H2;;/b33-25-,34-25-,35-26-,36-28-,37-26-,39-28-,43-42-,44-42-;;;; |
| InChIKey | GBTDYAYBDIONMX-UGECTPNSSA-N |
| XLogP | 7.27 |
| TPSA | 112.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.48 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|