C34H36F3N5O4Si — CID 175456138
5-[5-[4-but-3-enyl-6-(methylamino)-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-1,3,4-oxadiazol-2-yl]-5-[tert-butyl(diphenyl)silyl]pent-1-en-1-one (PubChem CID 175456138) has the molecular formula C34H36F3N5O4Si and a molecular weight of 663.77 g/mol. Its IUPAC name is 5-[5-[4-but-3-enyl-6-(methylamino)-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-1,3,4-oxadiazol-2-yl]-5-[tert-butyl(diphenyl)silyl]pent-1-en-1-one.
| Compound Name | 5-[5-[4-but-3-enyl-6-(methylamino)-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-1,3,4-oxadiazol-2-yl]-5-[tert-butyl(diphenyl)silyl]pent-1-en-1-one |
|---|---|
| PubChem CID | 175456138 |
| Molecular Formula | C34H36F3N5O4Si |
| Molecular Weight | 663.77 g/mol |
| Exact Mass | 663.25 |
| IUPAC Name | 5-[5-[4-but-3-enyl-6-(methylamino)-3-nitro-5-(trifluoromethyl)-2-pyridinyl]-1,3,4-oxadiazol-2-yl]-5-[tert-butyl(diphenyl)silyl]pent-1-en-1-one |
| SMILES | C=CCCc1c([N+](=O)[O-])c(-c2nnc(C(CCC=C=O)[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)o2)nc(NC)c1C(F)(F)F |
| InChI | InChI=1S/C34H36F3N5O4Si/c1-6-7-20-25-27(34(35,36)37)30(38-5)39-28(29(25)42(44)45)32-41-40-31(46-32)26(21-14-15-22-43)47(33(2,3)4,23-16-10-8-11-17-23)24-18-12-9-13-19-24/h6,8-13,15-19,26H,1,7,14,20-21H2,2-5H3,(H,38,39) |
| InChIKey | NBPVRUGHHVLCNY-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 124.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.77 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|