About 4-carboxy-5-[(1,2-dimethylimidazol-4-yl)-sulfinatoamino]-1,3-thiazole
4-carboxy-5-[(1,2-dimethylimidazol-4-yl)-sulfinatoamino]-1,3-thiazole (PubChem CID 175456434) has the molecular formula C9H9N4O4S2-
and a molecular weight of 301.33 g/mol. Its IUPAC name is 4-carboxy-5-[(1,2-dimethylimidazol-4-yl)-sulfinatoamino]-1,3-thiazole.
Molecular Properties
| Compound Name | 4-carboxy-5-[(1,2-dimethylimidazol-4-yl)-sulfinatoamino]-1,3-thiazole |
| PubChem CID | 175456434 |
| Molecular Formula | C9H9N4O4S2- |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | 4-carboxy-5-[(1,2-dimethylimidazol-4-yl)-sulfinatoamino]-1,3-thiazole |
| SMILES | Cc1nc(N(c2scnc2C(=O)O)S(=O)[O-])cn1C |
| InChI | InChI=1S/C9H10N4O4S2/c1-5-11-6(3-12(5)2)13(19(16)17)8-7(9(14)15)10-4-18-8/h3-4H,1-2H3,(H,14,15)(H,16,17)/p-1 |
| InChIKey | ZVMHHOOZOKYGLM-UHFFFAOYSA-M |
| XLogP | 0.82 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-carboxy-5-[(1,2-dimethylimidazol-4-yl)-sulfinatoamino]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-carboxy-5-[(1,2-dimethylimidazol-4-yl)-sulfinatoamino]-1,3-thiazole?
The IUPAC name of 4-carboxy-5-[(1,2-dimethylimidazol-4-yl)-sulfinatoamino]-1,3-thiazole (CID 175456434) is 4-carboxy-5-[(1,2-dimethylimidazol-4-yl)-sulfinatoamino]-1,3-thiazole.
What is the SMILES notation for 4-carboxy-5-[(1,2-dimethylimidazol-4-yl)-sulfinatoamino]-1,3-thiazole?
The canonical SMILES for 4-carboxy-5-[(1,2-dimethylimidazol-4-yl)-sulfinatoamino]-1,3-thiazole is Cc1nc(N(c2scnc2C(=O)O)S(=O)[O-])cn1C.
What is the InChIKey of 4-carboxy-5-[(1,2-dimethylimidazol-4-yl)-sulfinatoamino]-1,3-thiazole?
The InChIKey is ZVMHHOOZOKYGLM-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10N4O4S2/c1-5-11-6(3-12(5)2)13(19(16)17)8-7(9(14)15)10-4-18-8/h3-4H,1-2H3,(H,14,15)(H,16,17)/p-1.
What are the key properties of 4-carboxy-5-[(1,2-dimethylimidazol-4-yl)-sulfinatoamino]-1,3-thiazole?
4-carboxy-5-[(1,2-dimethylimidazol-4-yl)-sulfinatoamino]-1,3-thiazole has a molecular weight of 301.33 g/mol, XLogP of 0.82, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-carboxy-5-[(1,2-dimethylimidazol-4-yl)-sulfinatoamino]-1,3-thiazole is sourced from PubChem (CID 175456434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).