C14H16N2O4S2 — CID 175456463
2-methyl-5-(2,4,6-trimethyl-N-sulfinoanilino)-1,3-thiazole-4-carboxylic acid (PubChem CID 175456463) has the molecular formula C14H16N2O4S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-methyl-5-(2,4,6-trimethyl-N-sulfinoanilino)-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-methyl-5-(2,4,6-trimethyl-N-sulfinoanilino)-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 175456463 |
| Molecular Formula | C14H16N2O4S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 2-methyl-5-(2,4,6-trimethyl-N-sulfinoanilino)-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1cc(C)c(N(c2sc(C)nc2C(=O)O)S(=O)O)c(C)c1 |
| InChI | InChI=1S/C14H16N2O4S2/c1-7-5-8(2)12(9(3)6-7)16(22(19)20)13-11(14(17)18)15-10(4)21-13/h5-6H,1-4H3,(H,17,18)(H,19,20) |
| InChIKey | AGYBTZKATPEJKT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|