About 4-benzyl-2-chloro-N',5-dimethylbenzenecarboximidamide
4-benzyl-2-chloro-N',5-dimethylbenzenecarboximidamide (PubChem CID 175456704) has the molecular formula C16H17ClN2
and a molecular weight of 272.78 g/mol. Its IUPAC name is 4-benzyl-2-chloro-N',5-dimethylbenzenecarboximidamide.
Molecular Properties
| Compound Name | 4-benzyl-2-chloro-N',5-dimethylbenzenecarboximidamide |
| PubChem CID | 175456704 |
| Molecular Formula | C16H17ClN2 |
| Molecular Weight | 272.78 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 4-benzyl-2-chloro-N',5-dimethylbenzenecarboximidamide |
| SMILES | C/N=C(\N)c1cc(C)c(Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C16H17ClN2/c1-11-8-14(16(18)19-2)15(17)10-13(11)9-12-6-4-3-5-7-12/h3-8,10H,9H2,1-2H3,(H2,18,19) |
| InChIKey | YIMWMNYFPDYMFC-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.78 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-2-chloro-N',5-dimethylbenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-2-chloro-N',5-dimethylbenzenecarboximidamide?
The IUPAC name of 4-benzyl-2-chloro-N',5-dimethylbenzenecarboximidamide (CID 175456704) is 4-benzyl-2-chloro-N',5-dimethylbenzenecarboximidamide.
What is the SMILES notation for 4-benzyl-2-chloro-N',5-dimethylbenzenecarboximidamide?
The canonical SMILES for 4-benzyl-2-chloro-N',5-dimethylbenzenecarboximidamide is C/N=C(\N)c1cc(C)c(Cc2ccccc2)cc1Cl.
What is the InChIKey of 4-benzyl-2-chloro-N',5-dimethylbenzenecarboximidamide?
The InChIKey is YIMWMNYFPDYMFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClN2/c1-11-8-14(16(18)19-2)15(17)10-13(11)9-12-6-4-3-5-7-12/h3-8,10H,9H2,1-2H3,(H2,18,19).
What are the key properties of 4-benzyl-2-chloro-N',5-dimethylbenzenecarboximidamide?
4-benzyl-2-chloro-N',5-dimethylbenzenecarboximidamide has a molecular weight of 272.78 g/mol, XLogP of 3.57, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-2-chloro-N',5-dimethylbenzenecarboximidamide is sourced from PubChem (CID 175456704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).