C17H14O6 — CID 175457113
4-methyl-2-benzofuran-1,3-dione;4,5,6,7-tetrahydro-2-benzofuran-1,3-dione (PubChem CID 175457113) has the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. Its IUPAC name is 4-methyl-2-benzofuran-1,3-dione;4,5,6,7-tetrahydro-2-benzofuran-1,3-dione.
| Compound Name | 4-methyl-2-benzofuran-1,3-dione;4,5,6,7-tetrahydro-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 175457113 |
| Molecular Formula | C17H14O6 |
| Molecular Weight | 314.29 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | 4-methyl-2-benzofuran-1,3-dione;4,5,6,7-tetrahydro-2-benzofuran-1,3-dione |
| SMILES | Cc1cccc2c1C(=O)OC2=O.O=C1OC(=O)C2=C1CCCC2 |
| InChI | InChI=1S/C9H6O3.C8H8O3/c1-5-3-2-4-6-7(5)9(11)12-8(6)10;9-7-5-3-1-2-4-6(5)8(10)11-7/h2-4H,1H3;1-4H2 |
| InChIKey | QIPHCXMGBXOKTD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|