C24H34O7 — CID 175457452
10-(5,8,11-trioxododec-1-en-3-yloxy)dodec-11-ene-2,5,8-trione (PubChem CID 175457452) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is 10-(5,8,11-trioxododec-1-en-3-yloxy)dodec-11-ene-2,5,8-trione.
| Compound Name | 10-(5,8,11-trioxododec-1-en-3-yloxy)dodec-11-ene-2,5,8-trione |
|---|---|
| PubChem CID | 175457452 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 10-(5,8,11-trioxododec-1-en-3-yloxy)dodec-11-ene-2,5,8-trione |
| SMILES | C=CC(CC(=O)CCC(=O)CCC(C)=O)OC(C=C)CC(=O)CCC(=O)CCC(C)=O |
| InChI | InChI=1S/C24H34O7/c1-5-23(15-21(29)13-11-19(27)9-7-17(3)25)31-24(6-2)16-22(30)14-12-20(28)10-8-18(4)26/h5-6,23-24H,1-2,7-16H2,3-4H3 |
| InChIKey | QEMJQJJJWXEIGW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 111.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|