C24H40O6 — CID 175457767
[(3R,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 175457767) has the molecular formula C24H40O6 and a molecular weight of 424.58 g/mol. Its IUPAC name is [(3R,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [(3R,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 175457767 |
| Molecular Formula | C24H40O6 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.28 |
| IUPAC Name | [(3R,3aR,6S,6aS)-3,6-dihydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)O[C@@]1(O)CO[C@@H]2[C@H](O)CO[C@@H]21 |
| InChI | InChI=1S/C24H40O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(26)30-24(27)19-29-22-20(25)18-28-23(22)24/h6-7,9-10,20,22-23,25,27H,2-5,8,11-19H2,1H3/b7-6-,10-9-/t20-,22-,23+,24+/m1/s1 |
| InChIKey | IHJBPUVEJTZCLX-JQCXCWSVSA-N |
| XLogP | 4.19 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|