C8H13F3O3S — CID 175457866
tert-butyl 3-(trifluoromethylsulfinyl)propanoate (PubChem CID 175457866) has the molecular formula C8H13F3O3S and a molecular weight of 246.25 g/mol. Its IUPAC name is tert-butyl 3-(trifluoromethylsulfinyl)propanoate.
| Compound Name | tert-butyl 3-(trifluoromethylsulfinyl)propanoate |
|---|---|
| PubChem CID | 175457866 |
| Molecular Formula | C8H13F3O3S |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | tert-butyl 3-(trifluoromethylsulfinyl)propanoate |
| SMILES | CC(C)(C)OC(=O)CCS(=O)C(F)(F)F |
| InChI | InChI=1S/C8H13F3O3S/c1-7(2,3)14-6(12)4-5-15(13)8(9,10)11/h4-5H2,1-3H3 |
| InChIKey | IAKSPHDIDIXRGU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |