C17H15N3O4S2 — CID 175459001
N-[amino-(4-phenyl-1,3-thiazol-2-yl)methyl]sulfanyl-2,3,4-trihydroxybenzamide (PubChem CID 175459001) has the molecular formula C17H15N3O4S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is N-[amino-(4-phenyl-1,3-thiazol-2-yl)methyl]sulfanyl-2,3,4-trihydroxybenzamide.
| Compound Name | N-[amino-(4-phenyl-1,3-thiazol-2-yl)methyl]sulfanyl-2,3,4-trihydroxybenzamide |
|---|---|
| PubChem CID | 175459001 |
| Molecular Formula | C17H15N3O4S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | N-[amino-(4-phenyl-1,3-thiazol-2-yl)methyl]sulfanyl-2,3,4-trihydroxybenzamide |
| SMILES | NC(SNC(=O)c1ccc(O)c(O)c1O)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H15N3O4S2/c18-15(17-19-11(8-25-17)9-4-2-1-3-5-9)26-20-16(24)10-6-7-12(21)14(23)13(10)22/h1-8,15,21-23H,18H2,(H,20,24) |
| InChIKey | XABWFWHYOAHZQP-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|