C23H21ClFN5O3 — CID 175459206
1-[3-[4-amino-7-chloro-3-[2-(2-fluoro-3,5-dimethoxyphenyl)ethynyl]pyrazolo[4,5-c]pyridin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 175459206) has the molecular formula C23H21ClFN5O3 and a molecular weight of 469.90 g/mol. Its IUPAC name is 1-[3-[4-amino-7-chloro-3-[2-(2-fluoro-3,5-dimethoxyphenyl)ethynyl]pyrazolo[4,5-c]pyridin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[4-amino-7-chloro-3-[2-(2-fluoro-3,5-dimethoxyphenyl)ethynyl]pyrazolo[4,5-c]pyridin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 175459206 |
| Molecular Formula | C23H21ClFN5O3 |
| Molecular Weight | 469.90 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 1-[3-[4-amino-7-chloro-3-[2-(2-fluoro-3,5-dimethoxyphenyl)ethynyl]pyrazolo[4,5-c]pyridin-1-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(n2nc(C#Cc3cc(OC)cc(OC)c3F)c3c(N)ncc(Cl)c32)C1 |
| InChI | InChI=1S/C23H21ClFN5O3/c1-4-19(31)29-8-7-14(12-29)30-22-16(24)11-27-23(26)20(22)17(28-30)6-5-13-9-15(32-2)10-18(33-3)21(13)25/h4,9-11,14H,1,7-8,12H2,2-3H3,(H2,26,27) |
| InChIKey | FYHCOWKKYWMBLC-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.90 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|