C24H32F2O6SSi — CID 175459290
[2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,4-dioxan-2-yl]-2,2-difluoroethyl] methanesulfonate (PubChem CID 175459290) has the molecular formula C24H32F2O6SSi and a molecular weight of 514.66 g/mol. Its IUPAC name is [2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,4-dioxan-2-yl]-2,2-difluoroethyl] methanesulfonate.
| Compound Name | [2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,4-dioxan-2-yl]-2,2-difluoroethyl] methanesulfonate |
|---|---|
| PubChem CID | 175459290 |
| Molecular Formula | C24H32F2O6SSi |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | [2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-1,4-dioxan-2-yl]-2,2-difluoroethyl] methanesulfonate |
| SMILES | CC(C)(C)[Si](OCC1COC(C(F)(F)COS(C)(=O)=O)CO1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32F2O6SSi/c1-23(2,3)34(20-11-7-5-8-12-20,21-13-9-6-10-14-21)32-16-19-15-30-22(17-29-19)24(25,26)18-31-33(4,27)28/h5-14,19,22H,15-18H2,1-4H3 |
| InChIKey | SMQGQVYTZJZYTA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|