About [5-(2-azido-1,1-difluoroethyl)-1,4-dioxan-2-yl]methanol
[5-(2-azido-1,1-difluoroethyl)-1,4-dioxan-2-yl]methanol (PubChem CID 175459295) has the molecular formula C7H11F2N3O3
and a molecular weight of 223.18 g/mol. Its IUPAC name is [5-(2-azido-1,1-difluoroethyl)-1,4-dioxan-2-yl]methanol.
Molecular Properties
| Compound Name | [5-(2-azido-1,1-difluoroethyl)-1,4-dioxan-2-yl]methanol |
| PubChem CID | 175459295 |
| Molecular Formula | C7H11F2N3O3 |
| Molecular Weight | 223.18 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | [5-(2-azido-1,1-difluoroethyl)-1,4-dioxan-2-yl]methanol |
| SMILES | [N-]=[N+]=NCC(F)(F)C1COC(CO)CO1 |
| InChI | InChI=1S/C7H11F2N3O3/c8-7(9,4-11-12-10)6-3-14-5(1-13)2-15-6/h5-6,13H,1-4H2 |
| InChIKey | WQMIFEFTNMYHKI-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-azido-1,1-difluoroethyl)-1,4-dioxan-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-azido-1,1-difluoroethyl)-1,4-dioxan-2-yl]methanol?
The IUPAC name of [5-(2-azido-1,1-difluoroethyl)-1,4-dioxan-2-yl]methanol (CID 175459295) is [5-(2-azido-1,1-difluoroethyl)-1,4-dioxan-2-yl]methanol.
What is the SMILES notation for [5-(2-azido-1,1-difluoroethyl)-1,4-dioxan-2-yl]methanol?
The canonical SMILES for [5-(2-azido-1,1-difluoroethyl)-1,4-dioxan-2-yl]methanol is [N-]=[N+]=NCC(F)(F)C1COC(CO)CO1.
What is the InChIKey of [5-(2-azido-1,1-difluoroethyl)-1,4-dioxan-2-yl]methanol?
The InChIKey is WQMIFEFTNMYHKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2N3O3/c8-7(9,4-11-12-10)6-3-14-5(1-13)2-15-6/h5-6,13H,1-4H2.
What are the key properties of [5-(2-azido-1,1-difluoroethyl)-1,4-dioxan-2-yl]methanol?
[5-(2-azido-1,1-difluoroethyl)-1,4-dioxan-2-yl]methanol has a molecular weight of 223.18 g/mol, XLogP of 0.71, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-azido-1,1-difluoroethyl)-1,4-dioxan-2-yl]methanol is sourced from PubChem (CID 175459295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).