About prop-2-enylidenecarbamic acid
prop-2-enylidenecarbamic acid (PubChem CID 175459397) has the molecular formula C4H5NO2
and a molecular weight of 99.09 g/mol. Its IUPAC name is prop-2-enylidenecarbamic acid.
Molecular Properties
| Compound Name | prop-2-enylidenecarbamic acid |
| PubChem CID | 175459397 |
| Molecular Formula | C4H5NO2 |
| Molecular Weight | 99.09 g/mol |
| Exact Mass | 99.03 |
| IUPAC Name | prop-2-enylidenecarbamic acid |
| SMILES | C=CC=NC(=O)O |
| InChI | InChI=1S/C4H5NO2/c1-2-3-5-4(6)7/h2-3H,1H2,(H,6,7) |
| InChIKey | LZNNHSCAYSJIKI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.09 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enylidenecarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enylidenecarbamic acid?
The IUPAC name of prop-2-enylidenecarbamic acid (CID 175459397) is prop-2-enylidenecarbamic acid.
What is the SMILES notation for prop-2-enylidenecarbamic acid?
The canonical SMILES for prop-2-enylidenecarbamic acid is C=CC=NC(=O)O.
What is the InChIKey of prop-2-enylidenecarbamic acid?
The InChIKey is LZNNHSCAYSJIKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5NO2/c1-2-3-5-4(6)7/h2-3H,1H2,(H,6,7).
What are the key properties of prop-2-enylidenecarbamic acid?
prop-2-enylidenecarbamic acid has a molecular weight of 99.09 g/mol, XLogP of 0.92, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enylidenecarbamic acid is sourced from PubChem (CID 175459397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).