C15H16F3IN2O2S — CID 175459672
N-(1,1-dioxothian-4-yl)-2-iodo-1-(1,2,2-trifluoroethyl)indol-4-amine (PubChem CID 175459672) has the molecular formula C15H16F3IN2O2S and a molecular weight of 472.27 g/mol. Its IUPAC name is N-(1,1-dioxothian-4-yl)-2-iodo-1-(1,2,2-trifluoroethyl)indol-4-amine.
| Compound Name | N-(1,1-dioxothian-4-yl)-2-iodo-1-(1,2,2-trifluoroethyl)indol-4-amine |
|---|---|
| PubChem CID | 175459672 |
| Molecular Formula | C15H16F3IN2O2S |
| Molecular Weight | 472.27 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | N-(1,1-dioxothian-4-yl)-2-iodo-1-(1,2,2-trifluoroethyl)indol-4-amine |
| SMILES | O=S1(=O)CCC(Nc2cccc3c2cc(I)n3C(F)C(F)F)CC1 |
| InChI | InChI=1S/C15H16F3IN2O2S/c16-14(17)15(18)21-12-3-1-2-11(10(12)8-13(21)19)20-9-4-6-24(22,23)7-5-9/h1-3,8-9,14-15,20H,4-7H2 |
| InChIKey | WZNWSEYSEWCGDV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|