About phenol;2H-phthalazin-1-one
phenol;2H-phthalazin-1-one (PubChem CID 175459904) has the molecular formula C20H18N2O3
and a molecular weight of 334.38 g/mol. Its IUPAC name is phenol;2H-phthalazin-1-one.
Molecular Properties
| Compound Name | phenol;2H-phthalazin-1-one |
| PubChem CID | 175459904 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | phenol;2H-phthalazin-1-one |
| SMILES | O=c1[nH]ncc2ccccc12.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C8H6N2O.2C6H6O/c11-8-7-4-2-1-3-6(7)5-9-10-8;2*7-6-4-2-1-3-5-6/h1-5H,(H,10,11);2*1-5,7H |
| InChIKey | LQNQHGXZDDVJRF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze phenol;2H-phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;2H-phthalazin-1-one?
The IUPAC name of phenol;2H-phthalazin-1-one (CID 175459904) is phenol;2H-phthalazin-1-one.
What is the SMILES notation for phenol;2H-phthalazin-1-one?
The canonical SMILES for phenol;2H-phthalazin-1-one is O=c1[nH]ncc2ccccc12.Oc1ccccc1.Oc1ccccc1.
What is the InChIKey of phenol;2H-phthalazin-1-one?
The InChIKey is LQNQHGXZDDVJRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O.2C6H6O/c11-8-7-4-2-1-3-6(7)5-9-10-8;2*7-6-4-2-1-3-5-6/h1-5H,(H,10,11);2*1-5,7H.
What are the key properties of phenol;2H-phthalazin-1-one?
phenol;2H-phthalazin-1-one has a molecular weight of 334.38 g/mol, XLogP of 3.71, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;2H-phthalazin-1-one is sourced from PubChem (CID 175459904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).