C33H50O4S — CID 175460606
[1-(2,4-ditert-butyl-3-hydroxyphenyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-sulfanylethyl] propanoate (PubChem CID 175460606) has the molecular formula C33H50O4S and a molecular weight of 542.83 g/mol. Its IUPAC name is [1-(2,4-ditert-butyl-3-hydroxyphenyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-sulfanylethyl] propanoate.
| Compound Name | [1-(2,4-ditert-butyl-3-hydroxyphenyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-sulfanylethyl] propanoate |
|---|---|
| PubChem CID | 175460606 |
| Molecular Formula | C33H50O4S |
| Molecular Weight | 542.83 g/mol |
| Exact Mass | 542.34 |
| IUPAC Name | [1-(2,4-ditert-butyl-3-hydroxyphenyl)-2-(3,5-ditert-butyl-4-hydroxyphenyl)-2-sulfanylethyl] propanoate |
| SMILES | CCC(=O)OC(c1ccc(C(C)(C)C)c(O)c1C(C)(C)C)C(S)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C33H50O4S/c1-14-24(34)37-28(20-15-16-21(30(2,3)4)27(36)25(20)33(11,12)13)29(38)19-17-22(31(5,6)7)26(35)23(18-19)32(8,9)10/h15-18,28-29,35-36,38H,14H2,1-13H3 |
| InChIKey | LXCDOYKBOZBUGX-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.83 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|