C32H33N9OS — CID 175460801
N-[3-[1-[5-[[[(cyanoamino)-(pyridin-4-ylamino)methylidene]amino]methyl]-1,3-thiazol-2-yl]indol-4-yl]phenyl]-3-(diethylamino)propanamide (PubChem CID 175460801) has the molecular formula C32H33N9OS and a molecular weight of 591.75 g/mol. Its IUPAC name is N-[3-[1-[5-[[[(cyanoamino)-(pyridin-4-ylamino)methylidene]amino]methyl]-1,3-thiazol-2-yl]indol-4-yl]phenyl]-3-(diethylamino)propanamide.
| Compound Name | N-[3-[1-[5-[[[(cyanoamino)-(pyridin-4-ylamino)methylidene]amino]methyl]-1,3-thiazol-2-yl]indol-4-yl]phenyl]-3-(diethylamino)propanamide |
|---|---|
| PubChem CID | 175460801 |
| Molecular Formula | C32H33N9OS |
| Molecular Weight | 591.75 g/mol |
| Exact Mass | 591.25 |
| IUPAC Name | N-[3-[1-[5-[[[(cyanoamino)-(pyridin-4-ylamino)methylidene]amino]methyl]-1,3-thiazol-2-yl]indol-4-yl]phenyl]-3-(diethylamino)propanamide |
| SMILES | CCN(CC)CCC(=O)Nc1cccc(-c2cccc3c2ccn3-c2ncc(C/N=C(\NC#N)Nc3ccncc3)s2)c1 |
| InChI | InChI=1S/C32H33N9OS/c1-3-40(4-2)17-14-30(42)38-25-8-5-7-23(19-25)27-9-6-10-29-28(27)13-18-41(29)32-36-21-26(43-32)20-35-31(37-22-33)39-24-11-15-34-16-12-24/h5-13,15-16,18-19,21H,3-4,14,17,20H2,1-2H3,(H,38,42)(H2,34,35,37,39) |
| InChIKey | MYWPYZSUQRVBOC-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.75 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|