C33H37N9OS — CID 175460806
1-cyano-2-[[2-[4-[3-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2,3-dihydroindol-1-yl]-1,3-thiazol-5-yl]methyl]-3-pyridin-4-ylguanidine (PubChem CID 175460806) has the molecular formula C33H37N9OS and a molecular weight of 607.79 g/mol. Its IUPAC name is 1-cyano-2-[[2-[4-[3-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2,3-dihydroindol-1-yl]-1,3-thiazol-5-yl]methyl]-3-pyridin-4-ylguanidine.
| Compound Name | 1-cyano-2-[[2-[4-[3-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2,3-dihydroindol-1-yl]-1,3-thiazol-5-yl]methyl]-3-pyridin-4-ylguanidine |
|---|---|
| PubChem CID | 175460806 |
| Molecular Formula | C33H37N9OS |
| Molecular Weight | 607.79 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | 1-cyano-2-[[2-[4-[3-[3-(4-methylpiperazin-1-yl)propoxy]phenyl]-2,3-dihydroindol-1-yl]-1,3-thiazol-5-yl]methyl]-3-pyridin-4-ylguanidine |
| SMILES | CN1CCN(CCCOc2cccc(-c3cccc4c3CCN4c3ncc(C/N=C(\NC#N)Nc4ccncc4)s3)c2)CC1 |
| InChI | InChI=1S/C33H37N9OS/c1-40-16-18-41(19-17-40)14-4-20-43-27-6-2-5-25(21-27)29-7-3-8-31-30(29)11-15-42(31)33-37-23-28(44-33)22-36-32(38-24-34)39-26-9-12-35-13-10-26/h2-3,5-10,12-13,21,23H,4,11,14-20,22H2,1H3,(H2,35,36,38,39) |
| InChIKey | PPXMOBMPPLMYKT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 104.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.79 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|