C11H9F14NO3 — CID 175460953
N-(1,3-dihydroxy-2-methylpropan-2-yl)-N,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoroheptanamide (PubChem CID 175460953) has the molecular formula C11H9F14NO3 and a molecular weight of 469.17 g/mol. Its IUPAC name is N-(1,3-dihydroxy-2-methylpropan-2-yl)-N,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoroheptanamide.
| Compound Name | N-(1,3-dihydroxy-2-methylpropan-2-yl)-N,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoroheptanamide |
|---|---|
| PubChem CID | 175460953 |
| Molecular Formula | C11H9F14NO3 |
| Molecular Weight | 469.17 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | N-(1,3-dihydroxy-2-methylpropan-2-yl)-N,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoroheptanamide |
| SMILES | CC(CO)(CO)N(F)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H9F14NO3/c1-5(2-27,3-28)26(25)4(29)6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h27-28H,2-3H2,1H3 |
| InChIKey | JHOUUONBSFMKGY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.17 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|