About 2,2-dimethyl-1-(2H-pyridin-1-yl)propan-1-one;hydrobromide
2,2-dimethyl-1-(2H-pyridin-1-yl)propan-1-one;hydrobromide (PubChem CID 175461218) has the molecular formula C10H16BrNO
and a molecular weight of 246.15 g/mol. Its IUPAC name is 2,2-dimethyl-1-(2H-pyridin-1-yl)propan-1-one;hydrobromide.
Molecular Properties
| Compound Name | 2,2-dimethyl-1-(2H-pyridin-1-yl)propan-1-one;hydrobromide |
| PubChem CID | 175461218 |
| Molecular Formula | C10H16BrNO |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2,2-dimethyl-1-(2H-pyridin-1-yl)propan-1-one;hydrobromide |
| SMILES | Br.CC(C)(C)C(=O)N1C=CC=CC1 |
| InChI | InChI=1S/C10H15NO.BrH/c1-10(2,3)9(12)11-7-5-4-6-8-11;/h4-7H,8H2,1-3H3;1H |
| InChIKey | ZDPSMDVUYPKLML-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,2-dimethyl-1-(2H-pyridin-1-yl)propan-1-one;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-1-(2H-pyridin-1-yl)propan-1-one;hydrobromide?
The IUPAC name of 2,2-dimethyl-1-(2H-pyridin-1-yl)propan-1-one;hydrobromide (CID 175461218) is 2,2-dimethyl-1-(2H-pyridin-1-yl)propan-1-one;hydrobromide.
What is the SMILES notation for 2,2-dimethyl-1-(2H-pyridin-1-yl)propan-1-one;hydrobromide?
The canonical SMILES for 2,2-dimethyl-1-(2H-pyridin-1-yl)propan-1-one;hydrobromide is Br.CC(C)(C)C(=O)N1C=CC=CC1.
What is the InChIKey of 2,2-dimethyl-1-(2H-pyridin-1-yl)propan-1-one;hydrobromide?
The InChIKey is ZDPSMDVUYPKLML-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO.BrH/c1-10(2,3)9(12)11-7-5-4-6-8-11;/h4-7H,8H2,1-3H3;1H.
What are the key properties of 2,2-dimethyl-1-(2H-pyridin-1-yl)propan-1-one;hydrobromide?
2,2-dimethyl-1-(2H-pyridin-1-yl)propan-1-one;hydrobromide has a molecular weight of 246.15 g/mol, XLogP of 2.52, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-1-(2H-pyridin-1-yl)propan-1-one;hydrobromide is sourced from PubChem (CID 175461218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).