C7H5F8NO — CID 175462206
3-(1,1,2,2,3,3,4,4-octafluorobutoxy)propanenitrile (PubChem CID 175462206) has the molecular formula C7H5F8NO and a molecular weight of 271.11 g/mol. Its IUPAC name is 3-(1,1,2,2,3,3,4,4-octafluorobutoxy)propanenitrile.
| Compound Name | 3-(1,1,2,2,3,3,4,4-octafluorobutoxy)propanenitrile |
|---|---|
| PubChem CID | 175462206 |
| Molecular Formula | C7H5F8NO |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | 3-(1,1,2,2,3,3,4,4-octafluorobutoxy)propanenitrile |
| SMILES | N#CCCOC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H5F8NO/c8-4(9)5(10,11)6(12,13)7(14,15)17-3-1-2-16/h4H,1,3H2 |
| InChIKey | KIQIIWSPVOVCIC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|