About 3-(1,2,3,3-tetrafluoropropoxy)propanenitrile
3-(1,2,3,3-tetrafluoropropoxy)propanenitrile (PubChem CID 175462208) has the molecular formula C6H7F4NO
and a molecular weight of 185.12 g/mol. Its IUPAC name is 3-(1,2,3,3-tetrafluoropropoxy)propanenitrile.
Molecular Properties
| Compound Name | 3-(1,2,3,3-tetrafluoropropoxy)propanenitrile |
| PubChem CID | 175462208 |
| Molecular Formula | C6H7F4NO |
| Molecular Weight | 185.12 g/mol |
| Exact Mass | 185.05 |
| IUPAC Name | 3-(1,2,3,3-tetrafluoropropoxy)propanenitrile |
| SMILES | N#CCCOC(F)C(F)C(F)F |
| InChI | InChI=1S/C6H7F4NO/c7-4(5(8)9)6(10)12-3-1-2-11/h4-6H,1,3H2 |
| InChIKey | ZYIOCRGMRQPDDF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.12 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(1,2,3,3-tetrafluoropropoxy)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2,3,3-tetrafluoropropoxy)propanenitrile?
The IUPAC name of 3-(1,2,3,3-tetrafluoropropoxy)propanenitrile (CID 175462208) is 3-(1,2,3,3-tetrafluoropropoxy)propanenitrile.
What is the SMILES notation for 3-(1,2,3,3-tetrafluoropropoxy)propanenitrile?
The canonical SMILES for 3-(1,2,3,3-tetrafluoropropoxy)propanenitrile is N#CCCOC(F)C(F)C(F)F.
What is the InChIKey of 3-(1,2,3,3-tetrafluoropropoxy)propanenitrile?
The InChIKey is ZYIOCRGMRQPDDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F4NO/c7-4(5(8)9)6(10)12-3-1-2-11/h4-6H,1,3H2.
What are the key properties of 3-(1,2,3,3-tetrafluoropropoxy)propanenitrile?
3-(1,2,3,3-tetrafluoropropoxy)propanenitrile has a molecular weight of 185.12 g/mol, XLogP of 1.82, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2,3,3-tetrafluoropropoxy)propanenitrile is sourced from PubChem (CID 175462208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).