C6H8F3NO — CID 175462226
3-(1,2,3-trifluoropropoxy)propanenitrile (PubChem CID 175462226) has the molecular formula C6H8F3NO and a molecular weight of 167.13 g/mol. Its IUPAC name is 3-(1,2,3-trifluoropropoxy)propanenitrile.
| Compound Name | 3-(1,2,3-trifluoropropoxy)propanenitrile |
|---|---|
| PubChem CID | 175462226 |
| Molecular Formula | C6H8F3NO |
| Molecular Weight | 167.13 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 3-(1,2,3-trifluoropropoxy)propanenitrile |
| SMILES | N#CCCOC(F)C(F)CF |
| InChI | InChI=1S/C6H8F3NO/c7-4-5(8)6(9)11-3-1-2-10/h5-6H,1,3-4H2 |
| InChIKey | AOQVULVDDYESGS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.13 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|