About potassium;5-tert-butyl-1,2,4-oxadiazole-3-carboxylic acid;hydride
potassium;5-tert-butyl-1,2,4-oxadiazole-3-carboxylic acid;hydride (PubChem CID 175462514) has the molecular formula C7H11KN2O3
and a molecular weight of 210.27 g/mol. Its IUPAC name is potassium;5-tert-butyl-1,2,4-oxadiazole-3-carboxylic acid;hydride.
Molecular Properties
| Compound Name | potassium;5-tert-butyl-1,2,4-oxadiazole-3-carboxylic acid;hydride |
| PubChem CID | 175462514 |
| Molecular Formula | C7H11KN2O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | potassium;5-tert-butyl-1,2,4-oxadiazole-3-carboxylic acid;hydride |
| SMILES | CC(C)(C)c1nc(C(=O)O)no1.[H-].[K+] |
| InChI | InChI=1S/C7H10N2O3.K.H/c1-7(2,3)6-8-4(5(10)11)9-12-6;;/h1-3H3,(H,10,11);;/q;+1;-1 |
| InChIKey | MTTLACHBMIXJFW-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze potassium;5-tert-butyl-1,2,4-oxadiazole-3-carboxylic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;5-tert-butyl-1,2,4-oxadiazole-3-carboxylic acid;hydride?
The IUPAC name of potassium;5-tert-butyl-1,2,4-oxadiazole-3-carboxylic acid;hydride (CID 175462514) is potassium;5-tert-butyl-1,2,4-oxadiazole-3-carboxylic acid;hydride.
What is the SMILES notation for potassium;5-tert-butyl-1,2,4-oxadiazole-3-carboxylic acid;hydride?
The canonical SMILES for potassium;5-tert-butyl-1,2,4-oxadiazole-3-carboxylic acid;hydride is CC(C)(C)c1nc(C(=O)O)no1.[H-].[K+].
What is the InChIKey of potassium;5-tert-butyl-1,2,4-oxadiazole-3-carboxylic acid;hydride?
The InChIKey is MTTLACHBMIXJFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3.K.H/c1-7(2,3)6-8-4(5(10)11)9-12-6;;/h1-3H3,(H,10,11);;/q;+1;-1.
What are the key properties of potassium;5-tert-butyl-1,2,4-oxadiazole-3-carboxylic acid;hydride?
potassium;5-tert-butyl-1,2,4-oxadiazole-3-carboxylic acid;hydride has a molecular weight of 210.27 g/mol, XLogP of -1.82, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;5-tert-butyl-1,2,4-oxadiazole-3-carboxylic acid;hydride is sourced from PubChem (CID 175462514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).