C14H16O5S2 — CID 175463401
2-(benzenesulfonyl)-4,4-dimethylcyclohexa-1,5-diene-1-sulfonic acid (PubChem CID 175463401) has the molecular formula C14H16O5S2 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-4,4-dimethylcyclohexa-1,5-diene-1-sulfonic acid.
| Compound Name | 2-(benzenesulfonyl)-4,4-dimethylcyclohexa-1,5-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 175463401 |
| Molecular Formula | C14H16O5S2 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 2-(benzenesulfonyl)-4,4-dimethylcyclohexa-1,5-diene-1-sulfonic acid |
| SMILES | CC1(C)C=CC(S(=O)(=O)O)=C(S(=O)(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C14H16O5S2/c1-14(2)9-8-12(21(17,18)19)13(10-14)20(15,16)11-6-4-3-5-7-11/h3-9H,10H2,1-2H3,(H,17,18,19) |
| InChIKey | OPDKPXADWARTPA-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|