About N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-(4-methylphenyl)hydroxylamine;methanesulfonic acid
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-(4-methylphenyl)hydroxylamine;methanesulfonic acid (PubChem CID 175464221) has the molecular formula C12H19N3O4S
and a molecular weight of 301.37 g/mol. Its IUPAC name is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-(4-methylphenyl)hydroxylamine;methanesulfonic acid.
Molecular Properties
| Compound Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-(4-methylphenyl)hydroxylamine;methanesulfonic acid |
| PubChem CID | 175464221 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-(4-methylphenyl)hydroxylamine;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.Cc1ccc(N(O)CC2=NCCN2)cc1 |
| InChI | InChI=1S/C11H15N3O.CH4O3S/c1-9-2-4-10(5-3-9)14(15)8-11-12-6-7-13-11;1-5(2,3)4/h2-5,15H,6-8H2,1H3,(H,12,13);1H3,(H,2,3,4) |
| InChIKey | RNAQGDDIMRJCOP-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-(4-methylphenyl)hydroxylamine;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-(4-methylphenyl)hydroxylamine;methanesulfonic acid?
The IUPAC name of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-(4-methylphenyl)hydroxylamine;methanesulfonic acid (CID 175464221) is N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-(4-methylphenyl)hydroxylamine;methanesulfonic acid.
What is the SMILES notation for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-(4-methylphenyl)hydroxylamine;methanesulfonic acid?
The canonical SMILES for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-(4-methylphenyl)hydroxylamine;methanesulfonic acid is CS(=O)(=O)O.Cc1ccc(N(O)CC2=NCCN2)cc1.
What is the InChIKey of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-(4-methylphenyl)hydroxylamine;methanesulfonic acid?
The InChIKey is RNAQGDDIMRJCOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O.CH4O3S/c1-9-2-4-10(5-3-9)14(15)8-11-12-6-7-13-11;1-5(2,3)4/h2-5,15H,6-8H2,1H3,(H,12,13);1H3,(H,2,3,4).
What are the key properties of N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-(4-methylphenyl)hydroxylamine;methanesulfonic acid?
N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-(4-methylphenyl)hydroxylamine;methanesulfonic acid has a molecular weight of 301.37 g/mol, XLogP of 0.70, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,5-dihydro-1H-imidazol-2-ylmethyl)-N-(4-methylphenyl)hydroxylamine;methanesulfonic acid is sourced from PubChem (CID 175464221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).